C31H31N2O3S+ — CID 59962962
(2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-(furan-2-yl)penta-2,4-dienylidene]-5-ethylsulfinyl-1,3-benzoxazole (PubChem CID 59962962) has the molecular formula C31H31N2O3S+ and a molecular weight of 511.67 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-(furan-2-yl)penta-2,4-dienylidene]-5-ethylsulfinyl-1,3-benzoxazole.
| Compound Name | (2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-(furan-2-yl)penta-2,4-dienylidene]-5-ethylsulfinyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 59962962 |
| Molecular Formula | C31H31N2O3S+ |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (2Z)-3-ethyl-2-[(2Z,4E)-5-(1-ethylquinolin-1-ium-4-yl)-3-(furan-2-yl)penta-2,4-dienylidene]-5-ethylsulfinyl-1,3-benzoxazole |
| SMILES | CCN1/C(=C/C=C(/C=C/c2cc[n+](CC)c3ccccc23)c2ccco2)Oc2ccc(S(=O)CC)cc21 |
| InChI | InChI=1S/C31H31N2O3S/c1-4-32-20-19-23(26-10-7-8-11-27(26)32)13-14-24(29-12-9-21-35-29)15-18-31-33(5-2)28-22-25(37(34)6-3)16-17-30(28)36-31/h7-22H,4-6H2,1-3H3/q+1 |
| InChIKey | HFTFGVXHOCBYMW-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|