C31H31N2OS+ — CID 58697442
1-ethyl-2-[5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[e][1,3]benzoxazole (PubChem CID 58697442) has the molecular formula C31H31N2OS+ and a molecular weight of 479.67 g/mol. Its IUPAC name is 1-ethyl-2-[5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[e][1,3]benzoxazole.
| Compound Name | 1-ethyl-2-[5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[e][1,3]benzoxazole |
|---|---|
| PubChem CID | 58697442 |
| Molecular Formula | C31H31N2OS+ |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 1-ethyl-2-[5-[1-(3-methylsulfanylpropyl)quinolin-1-ium-4-yl]penta-2,4-dienylidene]benzo[e][1,3]benzoxazole |
| SMILES | CCN1C(=CC=CC=Cc2cc[n+](CCCSC)c3ccccc23)Oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C31H31N2OS/c1-3-33-30(34-29-19-18-24-13-7-8-15-27(24)31(29)33)17-6-4-5-12-25-20-22-32(21-11-23-35-2)28-16-10-9-14-26(25)28/h4-10,12-20,22H,3,11,21,23H2,1-2H3/q+1 |
| InChIKey | RCDDYAYMAQBZCA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|