C25H27N2Se+ — CID 6437095
(2E)-2-[(E)-3-(1-butylquinolin-1-ium-4-yl)prop-2-enylidene]-3-ethyl-1,3-benzoselenazole (PubChem CID 6437095) has the molecular formula C25H27N2Se+ and a molecular weight of 434.47 g/mol. Its IUPAC name is (2E)-2-[(E)-3-(1-butylquinolin-1-ium-4-yl)prop-2-enylidene]-3-ethyl-1,3-benzoselenazole.
| Compound Name | (2E)-2-[(E)-3-(1-butylquinolin-1-ium-4-yl)prop-2-enylidene]-3-ethyl-1,3-benzoselenazole |
|---|---|
| PubChem CID | 6437095 |
| Molecular Formula | C25H27N2Se+ |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (2E)-2-[(E)-3-(1-butylquinolin-1-ium-4-yl)prop-2-enylidene]-3-ethyl-1,3-benzoselenazole |
| SMILES | CCCC[n+]1ccc(/C=C/C=C2/[Se]c3ccccc3N2CC)c2ccccc21 |
| InChI | InChI=1S/C25H27N2Se/c1-3-5-18-26-19-17-20(21-12-6-7-13-22(21)26)11-10-16-25-27(4-2)23-14-8-9-15-24(23)28-25/h6-17,19H,3-5,18H2,1-2H3/q+1 |
| InChIKey | JTGWKRRVZTVZPM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|