C26H27N2O3S+ — CID 6612237
3-[4-[(E,3E)-3-(1-ethylquinolin-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 6612237) has the molecular formula C26H27N2O3S+ and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-[4-[(E,3E)-3-(1-ethylquinolin-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[(E,3E)-3-(1-ethylquinolin-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 6612237 |
| Molecular Formula | C26H27N2O3S+ |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-[4-[(E,3E)-3-(1-ethylquinolin-2-ylidene)prop-1-enyl]quinolin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C/C=C/c2cc[n+](CCCS(=O)(=O)O)c3ccccc23)C=Cc2ccccc21 |
| InChI | InChI=1S/C26H26N2O3S/c1-2-28-23(16-15-22-9-3-5-13-25(22)28)11-7-10-21-17-19-27(18-8-20-32(29,30)31)26-14-6-4-12-24(21)26/h3-7,9-17,19H,2,8,18,20H2,1H3/p+1 |
| InChIKey | VHDUBNQVOFRZST-UHFFFAOYSA-O |
| XLogP | 4.86 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|