C25H25N2+ — CID 6994242
1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline (PubChem CID 6994242) has the molecular formula C25H25N2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline.
| Compound Name | 1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline |
|---|---|
| PubChem CID | 6994242 |
| Molecular Formula | C25H25N2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-ethyl-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]quinoline |
| SMILES | CCN1C(=C/C=C/c2ccc3ccccc3[n+]2CC)C=Cc2ccccc21 |
| InChI | InChI=1S/C25H25N2/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2/h5-19H,3-4H2,1-2H3/q+1 |
| InChIKey | HQCBCYUEDZNVBO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|