C32H38N2 — CID 162118638
carbanide;1-ethyl-2-[3-[2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-4-methylhex-2-enylidene]quinoline (PubChem CID 162118638) has the molecular formula C32H38N2 and a molecular weight of 450.67 g/mol. Its IUPAC name is carbanide;1-ethyl-2-[3-[2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-4-methylhex-2-enylidene]quinoline.
| Compound Name | carbanide;1-ethyl-2-[3-[2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-4-methylhex-2-enylidene]quinoline |
|---|---|
| PubChem CID | 162118638 |
| Molecular Formula | C32H38N2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | carbanide;1-ethyl-2-[3-[2-(1-ethylquinolin-1-ium-2-yl)ethenyl]-4-methylhex-2-enylidene]quinoline |
| SMILES | CCC(C)C(C=Cc1ccc2ccccc2[n+]1CC)=CC=C1C=Cc2ccccc2N1CC.[CH3-] |
| InChI | InChI=1S/C31H35N2.CH3/c1-5-24(4)25(16-20-28-22-18-26-12-8-10-14-30(26)32(28)6-2)17-21-29-23-19-27-13-9-11-15-31(27)33(29)7-3;/h8-24H,5-7H2,1-4H3;1H3/q+1;-1 |
| InChIKey | ZHCLVWYRNBKOCZ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|