C38H41ClN2O3S — CID 44669734
(2E)-1-butyl-2-[(2Z,4E)-5-(1-butylquinolin-1-ium-2-yl)-3-chloropenta-2,4-dienylidene]quinoline;4-methylbenzenesulfonate (PubChem CID 44669734) has the molecular formula C38H41ClN2O3S and a molecular weight of 641.28 g/mol. Its IUPAC name is (2E)-1-butyl-2-[(2Z,4E)-5-(1-butylquinolin-1-ium-2-yl)-3-chloropenta-2,4-dienylidene]quinoline;4-methylbenzenesulfonate.
| Compound Name | (2E)-1-butyl-2-[(2Z,4E)-5-(1-butylquinolin-1-ium-2-yl)-3-chloropenta-2,4-dienylidene]quinoline;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 44669734 |
| Molecular Formula | C38H41ClN2O3S |
| Molecular Weight | 641.28 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | (2E)-1-butyl-2-[(2Z,4E)-5-(1-butylquinolin-1-ium-2-yl)-3-chloropenta-2,4-dienylidene]quinoline;4-methylbenzenesulfonate |
| SMILES | CCCCN1/C(=C/C=C(Cl)/C=C/c2ccc3ccccc3[n+]2CCCC)C=Cc2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C31H34ClN2.C7H8O3S/c1-3-5-23-33-28(19-15-25-11-7-9-13-30(25)33)21-17-27(32)18-22-29-20-16-26-12-8-10-14-31(26)34(29)24-6-4-2;1-6-2-4-7(5-3-6)11(8,9)10/h7-22H,3-6,23-24H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | OAWBZAQUUDXHBG-UHFFFAOYSA-M |
| XLogP | 9.18 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.28 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|