C28H28N2O4S2 — CID 21233397
(2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-5-ol;4-methylbenzenesulfonate (PubChem CID 21233397) has the molecular formula C28H28N2O4S2 and a molecular weight of 520.68 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-5-ol;4-methylbenzenesulfonate.
| Compound Name | (2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-5-ol;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 21233397 |
| Molecular Formula | C28H28N2O4S2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | (2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-5-ol;4-methylbenzenesulfonate |
| SMILES | CCN1/C(=C/c2ccc3ccccc3[n+]2CC)Sc2ccc(O)cc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N2OS.C7H8O3S/c1-3-22-16(10-9-15-7-5-6-8-18(15)22)13-21-23(4-2)19-14-17(24)11-12-20(19)25-21;1-6-2-4-7(5-3-6)11(8,9)10/h5-14H,3-4H2,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | FGLWERMQSHZHRV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|