C22H23IN2OS — CID 45488287
2-[(2Z)-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol iodide (PubChem CID 45488287) has the molecular formula C22H23IN2OS and a molecular weight of 490.41 g/mol. Its IUPAC name is 2-[(2Z)-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol iodide.
| Compound Name | 2-[(2Z)-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol iodide |
|---|---|
| PubChem CID | 45488287 |
| Molecular Formula | C22H23IN2OS |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2-[(2Z)-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-6-methyl-1,3-benzothiazol-3-yl]ethanol iodide |
| SMILES | CC[n+]1c(/C=C2\Sc3cc(C)ccc3N2CCO)ccc2ccccc21.[I-] |
| InChI | InChI=1S/C22H23N2OS.HI/c1-3-23-18(10-9-17-6-4-5-7-19(17)23)15-22-24(12-13-25)20-11-8-16(2)14-21(20)26-22;/h4-11,14-15,25H,3,12-13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BCZVVNKNUHSYKQ-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|