C23H24N3OS+ — CID 24869189
N-[(2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-6-yl]acetamide (PubChem CID 24869189) has the molecular formula C23H24N3OS+ and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[(2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | N-[(2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 24869189 |
| Molecular Formula | C23H24N3OS+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[(2Z)-3-ethyl-2-[(1-ethylquinolin-1-ium-2-yl)methylidene]-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CCN1/C(=C/c2ccc3ccccc3[n+]2CC)Sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C23H23N3OS/c1-4-25-19(12-10-17-8-6-7-9-20(17)25)15-23-26(5-2)21-13-11-18(24-16(3)27)14-22(21)28-23/h6-15H,4-5H2,1-3H3/p+1 |
| InChIKey | IYYRYYPASVADAQ-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 36.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|