C26H29IN4O2S2 — CID 163253763
N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide (PubChem CID 163253763) has the molecular formula C26H29IN4O2S2 and a molecular weight of 620.58 g/mol. Its IUPAC name is N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide.
| Compound Name | N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide |
|---|---|
| PubChem CID | 163253763 |
| Molecular Formula | C26H29IN4O2S2 |
| Molecular Weight | 620.58 g/mol |
| Exact Mass | 620.08 |
| IUPAC Name | N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide |
| SMILES | CCN1/C(=C\C(C)=C\c2sc3cc(NC(C)=O)ccc3[n+]2CC)Sc2cc(NC(C)=O)ccc21.[I-] |
| InChI | InChI=1S/C26H28N4O2S2.HI/c1-6-29-21-10-8-19(27-17(4)31)14-23(21)33-25(29)12-16(3)13-26-30(7-2)22-11-9-20(28-18(5)32)15-24(22)34-26;/h8-15H,6-7H2,1-5H3,(H-,27,28,31,32);1H |
| InChIKey | STOFEAGENWEHJT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|