C25H27IN4O2S2 — CID 163253768
N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide (PubChem CID 163253768) has the molecular formula C25H27IN4O2S2 and a molecular weight of 606.56 g/mol. Its IUPAC name is N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide.
| Compound Name | N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide |
|---|---|
| PubChem CID | 163253768 |
| Molecular Formula | C25H27IN4O2S2 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | N-[(2E)-2-[(E)-3-(6-acetamido-3-ethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-ethyl-1,3-benzothiazol-6-yl]acetamide iodide |
| SMILES | CCN1/C(=C\C=C\c2sc3cc(NC(C)=O)ccc3[n+]2CC)Sc2cc(NC(C)=O)ccc21.[I-] |
| InChI | InChI=1S/C25H26N4O2S2.HI/c1-5-28-20-12-10-18(26-16(3)30)14-22(20)32-24(28)8-7-9-25-29(6-2)21-13-11-19(27-17(4)31)15-23(21)33-25;/h7-15H,5-6H2,1-4H3,(H-,26,27,30,31);1H |
| InChIKey | ZHDOTLPSNRLKJV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|