C25H29N2O2S2+ — CID 6167527
2-[(2E)-3-ethyl-2-[(E)-3-[3-ethyl-6-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-6-yl]ethanol (PubChem CID 6167527) has the molecular formula C25H29N2O2S2+ and a molecular weight of 453.65 g/mol. Its IUPAC name is 2-[(2E)-3-ethyl-2-[(E)-3-[3-ethyl-6-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-6-yl]ethanol.
| Compound Name | 2-[(2E)-3-ethyl-2-[(E)-3-[3-ethyl-6-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-6-yl]ethanol |
|---|---|
| PubChem CID | 6167527 |
| Molecular Formula | C25H29N2O2S2+ |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-[(2E)-3-ethyl-2-[(E)-3-[3-ethyl-6-(2-hydroxyethyl)-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-6-yl]ethanol |
| SMILES | CCN1/C(=C\C=C\c2sc3cc(CCO)ccc3[n+]2CC)Sc2cc(CCO)ccc21 |
| InChI | InChI=1S/C25H29N2O2S2/c1-3-26-20-10-8-18(12-14-28)16-22(20)30-24(26)6-5-7-25-27(4-2)21-11-9-19(13-15-29)17-23(21)31-25/h5-11,16-17,28-29H,3-4,12-15H2,1-2H3/q+1 |
| InChIKey | IMJHLEJEIVRZKH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|