C26H30N3O2+ — CID 123382368
N-[3-ethyl-2-[(1-pentylquinolin-1-ium-2-yl)methylidene]-1,3-benzoxazol-6-yl]acetamide (PubChem CID 123382368) has the molecular formula C26H30N3O2+ and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[3-ethyl-2-[(1-pentylquinolin-1-ium-2-yl)methylidene]-1,3-benzoxazol-6-yl]acetamide.
| Compound Name | N-[3-ethyl-2-[(1-pentylquinolin-1-ium-2-yl)methylidene]-1,3-benzoxazol-6-yl]acetamide |
|---|---|
| PubChem CID | 123382368 |
| Molecular Formula | C26H30N3O2+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-[3-ethyl-2-[(1-pentylquinolin-1-ium-2-yl)methylidene]-1,3-benzoxazol-6-yl]acetamide |
| SMILES | CCCCC[n+]1c(C=C2Oc3cc(NC(C)=O)ccc3N2CC)ccc2ccccc21 |
| InChI | InChI=1S/C26H29N3O2/c1-4-6-9-16-29-22(14-12-20-10-7-8-11-23(20)29)18-26-28(5-2)24-15-13-21(27-19(3)30)17-25(24)31-26/h7-8,10-15,17-18H,4-6,9,16H2,1-3H3/p+1 |
| InChIKey | GAQMEQOURAREKA-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|