C40H41N4O4+ — CID 59061816
3-butyl-2-[3-[3-butyl-5-(phenylcarbamoyl)-1,3-benzoxazol-3-ium-2-yl]-2-methylprop-2-enylidene]-N-phenyl-1,3-benzoxazole-5-carboxamide (PubChem CID 59061816) has the molecular formula C40H41N4O4+ and a molecular weight of 641.79 g/mol. Its IUPAC name is 3-butyl-2-[3-[3-butyl-5-(phenylcarbamoyl)-1,3-benzoxazol-3-ium-2-yl]-2-methylprop-2-enylidene]-N-phenyl-1,3-benzoxazole-5-carboxamide.
| Compound Name | 3-butyl-2-[3-[3-butyl-5-(phenylcarbamoyl)-1,3-benzoxazol-3-ium-2-yl]-2-methylprop-2-enylidene]-N-phenyl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 59061816 |
| Molecular Formula | C40H41N4O4+ |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | 3-butyl-2-[3-[3-butyl-5-(phenylcarbamoyl)-1,3-benzoxazol-3-ium-2-yl]-2-methylprop-2-enylidene]-N-phenyl-1,3-benzoxazole-5-carboxamide |
| SMILES | CCCCN1C(=CC(C)=Cc2oc3ccc(C(=O)Nc4ccccc4)cc3[n+]2CCCC)Oc2ccc(C(=O)Nc3ccccc3)cc21 |
| InChI | InChI=1S/C40H40N4O4/c1-4-6-22-43-33-26-29(39(45)41-31-14-10-8-11-15-31)18-20-35(33)47-37(43)24-28(3)25-38-44(23-7-5-2)34-27-30(19-21-36(34)48-38)40(46)42-32-16-12-9-13-17-32/h8-21,24-27H,4-7,22-23H2,1-3H3,(H-,41,42,45,46)/p+1 |
| InChIKey | RAIRJMKUNBYABU-UHFFFAOYSA-O |
| XLogP | 8.97 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|