C37H36KN2O8S2 — CID 170853610
CID 170853610 (PubChem CID 170853610) has the molecular formula C37H36KN2O8S2 and a molecular weight of 739.93 g/mol.
| Compound Name | CID 170853610 |
|---|---|
| PubChem CID | 170853610 |
| Molecular Formula | C37H36KN2O8S2 |
| Molecular Weight | 739.93 g/mol |
| Exact Mass | 739.16 |
| IUPAC Name | — |
| SMILES | CCC(=Cc1oc2ccc(-c3ccccc3)cc2[n+]1CCCS(=O)(=O)[O-])C=C1Oc2ccc(-c3ccccc3)cc2N1CCCS(=O)(=O)O.[K] |
| InChI | InChI=1S/C37H36N2O8S2.K/c1-2-27(23-36-38(19-9-21-48(40,41)42)32-25-30(15-17-34(32)46-36)28-11-5-3-6-12-28)24-37-39(20-10-22-49(43,44)45)33-26-31(16-18-35(33)47-37)29-13-7-4-8-14-29;/h3-8,11-18,23-26H,2,9-10,19-22H2,1H3,(H-,40,41,42,43,44,45); |
| InChIKey | XRGZKJJFWOTWDE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.93 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|