C34H40ClN3O5S+2 — CID 91506198
3-[2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]propyl-trimethylazanium (PubChem CID 91506198) has the molecular formula C34H40ClN3O5S+2 and a molecular weight of 638.23 g/mol. Its IUPAC name is 3-[2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]propyl-trimethylazanium.
| Compound Name | 3-[2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 91506198 |
| Molecular Formula | C34H40ClN3O5S+2 |
| Molecular Weight | 638.23 g/mol |
| Exact Mass | 637.24 |
| IUPAC Name | 3-[2-[2-[[5-chloro-3-(3-sulfopropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]propyl-trimethylazanium |
| SMILES | CCC(=Cc1oc2ccc(-c3ccccc3)cc2[n+]1CCC[N+](C)(C)C)C=C1Oc2ccc(Cl)cc2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C34H39ClN3O5S/c1-5-25(22-34-37(18-10-20-44(39,40)41)30-24-28(35)14-16-32(30)43-34)21-33-36(17-9-19-38(2,3)4)29-23-27(13-15-31(29)42-33)26-11-7-6-8-12-26/h6-8,11-16,21-24H,5,9-10,17-20H2,1-4H3/q+1/p+1 |
| InChIKey | IDTNNDFFPFQDOF-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.23 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|