C36H43N2O8S2+ — CID 59875433
4-[5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid (PubChem CID 59875433) has the molecular formula C36H43N2O8S2+ and a molecular weight of 695.88 g/mol. Its IUPAC name is 4-[5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59875433 |
| Molecular Formula | C36H43N2O8S2+ |
| Molecular Weight | 695.88 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | 4-[5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(2-sulfoethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]butane-1-sulfonic acid |
| SMILES | CCC(=Cc1oc2ccc(-c3ccccc3)cc2[n+]1CCS(=O)(=O)O)C=C1Oc2ccc(C(C)(C)CC)cc2N1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C36H42N2O8S2/c1-5-26(22-34-37(18-10-11-20-47(39,40)41)31-25-29(36(3,4)6-2)15-17-33(31)46-34)23-35-38(19-21-48(42,43)44)30-24-28(14-16-32(30)45-35)27-12-8-7-9-13-27/h7-9,12-17,22-25H,5-6,10-11,18-21H2,1-4H3,(H-,39,40,41,42,43,44)/p+1 |
| InChIKey | UDBBAOAOVUNEGR-UHFFFAOYSA-O |
| XLogP | 7.16 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.88 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|