C32H34N2O8S2 — CID 59943181
[5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methanesulfonate (PubChem CID 59943181) has the molecular formula C32H34N2O8S2 and a molecular weight of 638.76 g/mol. Its IUPAC name is [5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methanesulfonate.
| Compound Name | [5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 59943181 |
| Molecular Formula | C32H34N2O8S2 |
| Molecular Weight | 638.76 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | [5-(2-methylbutan-2-yl)-2-[2-[[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]butylidene]-1,3-benzoxazol-3-yl]methanesulfonate |
| SMILES | CCC(=Cc1oc2ccc(-c3ccccc3)cc2[n+]1CS(=O)(=O)O)C=C1Oc2ccc(C(C)(C)CC)cc2N1CS(=O)(=O)[O-] |
| InChI | InChI=1S/C32H34N2O8S2/c1-5-22(17-31-34(21-44(38,39)40)27-19-25(32(3,4)6-2)13-15-29(27)42-31)16-30-33(20-43(35,36)37)26-18-24(12-14-28(26)41-30)23-10-8-7-9-11-23/h7-19H,5-6,20-21H2,1-4H3,(H-,35,36,37,38,39,40) |
| InChIKey | WUIJFUYEIZTLQT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|