C35H35N2O5S+ — CID 59984092
4-[2-[(3-butyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 59984092) has the molecular formula C35H35N2O5S+ and a molecular weight of 595.74 g/mol. Its IUPAC name is 4-[2-[(3-butyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[(3-butyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59984092 |
| Molecular Formula | C35H35N2O5S+ |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 4-[2-[(3-butyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CCCCN1C(=Cc2oc3ccc(-c4ccccc4)cc3[n+]2CCCCS(=O)(=O)O)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C35H34N2O5S/c1-2-3-20-36-30-23-28(26-12-6-4-7-13-26)16-18-32(30)41-34(36)25-35-37(21-10-11-22-43(38,39)40)31-24-29(17-19-33(31)42-35)27-14-8-5-9-15-27/h4-9,12-19,23-25H,2-3,10-11,20-22H2,1H3/p+1 |
| InChIKey | XASSOEKIKUQQTH-UHFFFAOYSA-O |
| XLogP | 7.72 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|