C30H33N2O9S2+ — CID 74008018
4-[2-[[5-methoxy-3-(4-sulfanyloxyperoxybutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonic acid (PubChem CID 74008018) has the molecular formula C30H33N2O9S2+ and a molecular weight of 629.73 g/mol. Its IUPAC name is 4-[2-[[5-methoxy-3-(4-sulfanyloxyperoxybutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[[5-methoxy-3-(4-sulfanyloxyperoxybutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 74008018 |
| Molecular Formula | C30H33N2O9S2+ |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 4-[2-[[5-methoxy-3-(4-sulfanyloxyperoxybutyl)-1,3-benzoxazol-3-ium-2-yl]methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonic acid |
| SMILES | COc1ccc2oc(C=C3Oc4ccc(-c5ccccc5)cc4N3CCCCS(=O)(=O)O)[n+](CCCCOOOS)c2c1 |
| InChI | InChI=1S/C30H32N2O9S2/c1-36-24-12-14-28-26(20-24)32(15-5-7-17-37-40-41-42)30(39-28)21-29-31(16-6-8-18-43(33,34)35)25-19-23(11-13-27(25)38-29)22-9-3-2-4-10-22/h2-4,9-14,19-21H,5-8,15-18H2,1H3,(H-,33,34,35,42)/p+1 |
| InChIKey | LIVRBKVVPGOSFY-UHFFFAOYSA-O |
| XLogP | 5.77 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|