C31H34N2O6S — CID 20659461
4-[(2Z)-2-[(5-methoxy-3-pentyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonate (PubChem CID 20659461) has the molecular formula C31H34N2O6S and a molecular weight of 562.69 g/mol. Its IUPAC name is 4-[(2Z)-2-[(5-methoxy-3-pentyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonate.
| Compound Name | 4-[(2Z)-2-[(5-methoxy-3-pentyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 20659461 |
| Molecular Formula | C31H34N2O6S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 4-[(2Z)-2-[(5-methoxy-3-pentyl-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazol-3-yl]butane-1-sulfonate |
| SMILES | CCCCC[n+]1c(/C=C2\Oc3ccc(-c4ccccc4)cc3N2CCCCS(=O)(=O)[O-])oc2ccc(OC)cc21 |
| InChI | InChI=1S/C31H34N2O6S/c1-3-4-8-17-33-27-21-25(37-2)14-16-29(27)39-31(33)22-30-32(18-9-10-19-40(34,35)36)26-20-24(13-15-28(26)38-30)23-11-6-5-7-12-23/h5-7,11-16,20-22H,3-4,8-10,17-19H2,1-2H3 |
| InChIKey | KAMAOFQNPHWFIU-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 95.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|