C27H27N2O6S+ — CID 91587623
ethene;[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid (PubChem CID 91587623) has the molecular formula C27H27N2O6S+ and a molecular weight of 507.59 g/mol. Its IUPAC name is ethene;[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid.
| Compound Name | ethene;[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 91587623 |
| Molecular Formula | C27H27N2O6S+ |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | ethene;[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]-5-methoxy-1,3-benzoxazol-3-ium-3-yl]methanesulfonic acid |
| SMILES | C=C.CCN1C(=Cc2oc3ccc(OC)cc3[n+]2CS(=O)(=O)O)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C25H22N2O6S.C2H4/c1-3-26-20-13-18(17-7-5-4-6-8-17)9-11-22(20)32-24(26)15-25-27(16-34(28,29)30)21-14-19(31-2)10-12-23(21)33-25;1-2/h4-15H,3,16H2,1-2H3;1-2H2/p+1 |
| InChIKey | XMNZLYVVLUMYBX-UHFFFAOYSA-O |
| XLogP | 5.26 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|