C26H22N2O8S2 — CID 20764993
[6-methoxy-2-[(Z)-[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]quinolin-1-ium-1-yl]methanesulfonate (PubChem CID 20764993) has the molecular formula C26H22N2O8S2 and a molecular weight of 554.60 g/mol. Its IUPAC name is [6-methoxy-2-[(Z)-[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]quinolin-1-ium-1-yl]methanesulfonate.
| Compound Name | [6-methoxy-2-[(Z)-[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]quinolin-1-ium-1-yl]methanesulfonate |
|---|---|
| PubChem CID | 20764993 |
| Molecular Formula | C26H22N2O8S2 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | [6-methoxy-2-[(Z)-[5-phenyl-3-(sulfomethyl)-1,3-benzoxazol-2-ylidene]methyl]quinolin-1-ium-1-yl]methanesulfonate |
| SMILES | COc1ccc2c(ccc(/C=C3\Oc4ccc(-c5ccccc5)cc4N3CS(=O)(=O)O)[n+]2CS(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C26H22N2O8S2/c1-35-22-10-11-23-20(13-22)7-9-21(27(23)16-37(29,30)31)15-26-28(17-38(32,33)34)24-14-19(8-12-25(24)36-26)18-5-3-2-4-6-18/h2-15H,16-17H2,1H3,(H-,29,30,31,32,33,34) |
| InChIKey | OFPYZQXKBBGPBB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|