C24H19N2O8S2+ — CID 59058651
(2Z)-2-[(6-methoxy-1-sulfoquinolin-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazole-3-sulfonic acid (PubChem CID 59058651) has the molecular formula C24H19N2O8S2+ and a molecular weight of 527.56 g/mol. Its IUPAC name is (2Z)-2-[(6-methoxy-1-sulfoquinolin-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazole-3-sulfonic acid.
| Compound Name | (2Z)-2-[(6-methoxy-1-sulfoquinolin-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazole-3-sulfonic acid |
|---|---|
| PubChem CID | 59058651 |
| Molecular Formula | C24H19N2O8S2+ |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | (2Z)-2-[(6-methoxy-1-sulfoquinolin-1-ium-2-yl)methylidene]-5-phenyl-1,3-benzoxazole-3-sulfonic acid |
| SMILES | COc1ccc2c(ccc(/C=C3\Oc4ccc(-c5ccccc5)cc4N3S(=O)(=O)O)[n+]2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C24H18N2O8S2/c1-33-20-10-11-21-18(13-20)7-9-19(25(21)35(27,28)29)15-24-26(36(30,31)32)22-14-17(8-12-23(22)34-24)16-5-3-2-4-6-16/h2-15H,1H3,(H-,27,28,29,30,31,32)/p+1 |
| InChIKey | MPDRRGGYYMCOEM-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 134.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|