C33H35NO8S2 — CID 59711526
4-[6-methoxy-2-[(Z)-[5-phenyl-3-(4-sulfinooxybutyl)-1,3-benzoxazol-2-ylidene]methyl]naphthalen-1-yl]butane-1-sulfonic acid (PubChem CID 59711526) has the molecular formula C33H35NO8S2 and a molecular weight of 637.78 g/mol. Its IUPAC name is 4-[6-methoxy-2-[(Z)-[5-phenyl-3-(4-sulfinooxybutyl)-1,3-benzoxazol-2-ylidene]methyl]naphthalen-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[6-methoxy-2-[(Z)-[5-phenyl-3-(4-sulfinooxybutyl)-1,3-benzoxazol-2-ylidene]methyl]naphthalen-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59711526 |
| Molecular Formula | C33H35NO8S2 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | 4-[6-methoxy-2-[(Z)-[5-phenyl-3-(4-sulfinooxybutyl)-1,3-benzoxazol-2-ylidene]methyl]naphthalen-1-yl]butane-1-sulfonic acid |
| SMILES | COc1ccc2c(CCCCS(=O)(=O)O)c(/C=C3\Oc4ccc(-c5ccccc5)cc4N3CCCCOS(=O)O)ccc2c1 |
| InChI | InChI=1S/C33H35NO8S2/c1-40-28-15-16-30-26(21-28)12-13-27(29(30)11-5-8-20-44(37,38)39)23-33-34(18-6-7-19-41-43(35)36)31-22-25(14-17-32(31)42-33)24-9-3-2-4-10-24/h2-4,9-10,12-17,21-23H,5-8,11,18-20H2,1H3,(H,35,36)(H,37,38,39)/b33-23- |
| InChIKey | VUEMOXIODZOUIV-SNCSUOKWSA-N |
| XLogP | 6.86 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|