C32H36N3O3+ — CID 164844437
4-[(2E)-2-[[1-(4-aminobutyl)-2-phenylquinolin-1-ium-4-yl]methylidene]-5-methoxy-1,3-benzoxazol-3-yl]butan-1-ol (PubChem CID 164844437) has the molecular formula C32H36N3O3+ and a molecular weight of 510.66 g/mol. Its IUPAC name is 4-[(2E)-2-[[1-(4-aminobutyl)-2-phenylquinolin-1-ium-4-yl]methylidene]-5-methoxy-1,3-benzoxazol-3-yl]butan-1-ol.
| Compound Name | 4-[(2E)-2-[[1-(4-aminobutyl)-2-phenylquinolin-1-ium-4-yl]methylidene]-5-methoxy-1,3-benzoxazol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 164844437 |
| Molecular Formula | C32H36N3O3+ |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 4-[(2E)-2-[[1-(4-aminobutyl)-2-phenylquinolin-1-ium-4-yl]methylidene]-5-methoxy-1,3-benzoxazol-3-yl]butan-1-ol |
| SMILES | COc1ccc2c(c1)N(CCCCO)/C(=C\c1cc(-c3ccccc3)[n+](CCCCN)c3ccccc13)O2 |
| InChI | InChI=1S/C32H36N3O3/c1-37-26-15-16-31-30(23-26)35(19-9-10-20-36)32(38-31)22-25-21-29(24-11-3-2-4-12-24)34(18-8-7-17-33)28-14-6-5-13-27(25)28/h2-6,11-16,21-23,36H,7-10,17-20,33H2,1H3/q+1 |
| InChIKey | CWPJDDHTMBDVDG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 71.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|