C32H37N3O2P+ — CID 167682651
4-[2-[3-[10-(4-aminobutyl)acridin-10-ium-9-yl]prop-2-enylidene]-3-methyl-3-oxo-1,3λ5-benzazaphosphol-1-yl]butan-1-ol (PubChem CID 167682651) has the molecular formula C32H37N3O2P+ and a molecular weight of 526.64 g/mol. Its IUPAC name is 4-[2-[3-[10-(4-aminobutyl)acridin-10-ium-9-yl]prop-2-enylidene]-3-methyl-3-oxo-1,3λ5-benzazaphosphol-1-yl]butan-1-ol.
| Compound Name | 4-[2-[3-[10-(4-aminobutyl)acridin-10-ium-9-yl]prop-2-enylidene]-3-methyl-3-oxo-1,3λ5-benzazaphosphol-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 167682651 |
| Molecular Formula | C32H37N3O2P+ |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 4-[2-[3-[10-(4-aminobutyl)acridin-10-ium-9-yl]prop-2-enylidene]-3-methyl-3-oxo-1,3λ5-benzazaphosphol-1-yl]butan-1-ol |
| SMILES | CP1(=O)C(=CC=Cc2c3ccccc3[n+](CCCCN)c3ccccc23)N(CCCCO)c2ccccc21 |
| InChI | InChI=1S/C32H37N3O2P/c1-38(37)31-19-7-6-18-30(31)35(23-10-11-24-36)32(38)20-12-15-25-26-13-2-4-16-28(26)34(22-9-8-21-33)29-17-5-3-14-27(25)29/h2-7,12-20,36H,8-11,21-24,33H2,1H3/q+1 |
| InChIKey | VTNKWTCAELBIED-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|