C27H29N2O6+ — CID 102086761
5-[2-[3-[3-(4-carboxybutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]pentanoic acid (PubChem CID 102086761) has the molecular formula C27H29N2O6+ and a molecular weight of 477.54 g/mol. Its IUPAC name is 5-[2-[3-[3-(4-carboxybutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]pentanoic acid.
| Compound Name | 5-[2-[3-[3-(4-carboxybutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 102086761 |
| Molecular Formula | C27H29N2O6+ |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 5-[2-[3-[3-(4-carboxybutyl)-1,3-benzoxazol-3-ium-2-yl]prop-2-enylidene]-1,3-benzoxazol-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1C(=CC=Cc2oc3ccccc3[n+]2CCCCC(=O)O)Oc2ccccc21 |
| InChI | InChI=1S/C27H28N2O6/c30-26(31)16-5-7-18-28-20-10-1-3-12-22(20)34-24(28)14-9-15-25-29(19-8-6-17-27(32)33)21-11-2-4-13-23(21)35-25/h1-4,9-15H,5-8,16-19H2,(H-,30,31,32,33)/p+1 |
| InChIKey | SVSDBUWSVGNUMS-UHFFFAOYSA-O |
| XLogP | 4.98 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|