C37H37N4O2+3 — CID 148649106
3-(3-pyridin-1-ium-1-ylpropyl)-2-[7-[3-(3-pyridin-1-ium-1-ylpropyl)-1,3-benzoxazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzoxazole (PubChem CID 148649106) has the molecular formula C37H37N4O2+3 and a molecular weight of 569.73 g/mol. Its IUPAC name is 3-(3-pyridin-1-ium-1-ylpropyl)-2-[7-[3-(3-pyridin-1-ium-1-ylpropyl)-1,3-benzoxazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzoxazole.
| Compound Name | 3-(3-pyridin-1-ium-1-ylpropyl)-2-[7-[3-(3-pyridin-1-ium-1-ylpropyl)-1,3-benzoxazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzoxazole |
|---|---|
| PubChem CID | 148649106 |
| Molecular Formula | C37H37N4O2+3 |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | 3-(3-pyridin-1-ium-1-ylpropyl)-2-[7-[3-(3-pyridin-1-ium-1-ylpropyl)-1,3-benzoxazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-1,3-benzoxazole |
| SMILES | C(=CC=Cc1oc2ccccc2[n+]1CCC[n+]1ccccc1)C=CC=C1Oc2ccccc2N1CCC[n+]1ccccc1 |
| InChI | InChI=1S/C37H37N4O2/c1(2-6-22-36-40(32-18-8-10-20-34(32)42-36)30-16-28-38-24-12-4-13-25-38)3-7-23-37-41(33-19-9-11-21-35(33)43-37)31-17-29-39-26-14-5-15-27-39/h1-15,18-27H,16-17,28-31H2/q+3 |
| InChIKey | NLOMFHTYHGZUPN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 37.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|