C29H31N3O+2 — CID 123480650
2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole (PubChem CID 123480650) has the molecular formula C29H31N3O+2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole.
| Compound Name | 2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 123480650 |
| Molecular Formula | C29H31N3O+2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole |
| SMILES | C[n+]1ccc(C=C2Oc3ccccc3N2CCCCCC[n+]2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H31N3O/c1-30-22-17-24(25-13-5-6-14-26(25)30)23-29-32(27-15-7-8-16-28(27)33-29)21-12-3-2-9-18-31-19-10-4-11-20-31/h4-8,10-11,13-17,19-20,22-23H,2-3,9,12,18,21H2,1H3/q+2 |
| InChIKey | YYSLQVSEYMXIHE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|