C29H31Cl2N3O9 — CID 159717540
2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole diperchlorate (PubChem CID 159717540) has the molecular formula C29H31Cl2N3O9 and a molecular weight of 636.49 g/mol. Its IUPAC name is 2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole diperchlorate.
| Compound Name | 2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole diperchlorate |
|---|---|
| PubChem CID | 159717540 |
| Molecular Formula | C29H31Cl2N3O9 |
| Molecular Weight | 636.49 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | 2-[(1-methylquinolin-1-ium-4-yl)methylidene]-3-(6-pyridin-1-ium-1-ylhexyl)-1,3-benzoxazole diperchlorate |
| SMILES | C[n+]1ccc(C=C2Oc3ccccc3N2CCCCCC[n+]2ccccc2)c2ccccc21.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H31N3O.2ClHO4/c1-30-22-17-24(25-13-5-6-14-26(25)30)23-29-32(27-15-7-8-16-28(27)33-29)21-12-3-2-9-18-31-19-10-4-11-20-31;2*2-1(3,4)5/h4-8,10-11,13-17,19-20,22-23H,2-3,9,12,18,21H2,1H3;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | MZPSLGULPICJEV-UHFFFAOYSA-L |
| XLogP | -4.10 |
| TPSA | 204.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.49 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|