C21H21ClN2O5S — CID 159254244
(2Z)-3-ethyl-2-[(E)-2-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzoxazole perchlorate (PubChem CID 159254244) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(E)-2-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzoxazole perchlorate.
| Compound Name | (2Z)-3-ethyl-2-[(E)-2-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzoxazole perchlorate |
|---|---|
| PubChem CID | 159254244 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | (2Z)-3-ethyl-2-[(E)-2-methyl-3-(3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-1,3-benzoxazole perchlorate |
| SMILES | CCN1/C(=C/C(C)=C/c2sc3ccccc3[n+]2C)Oc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H21N2OS.ClHO4/c1-4-23-16-9-5-7-11-18(16)24-20(23)13-15(2)14-21-22(3)17-10-6-8-12-19(17)25-21;2-1(3,4)5/h5-14H,4H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KVRNKKBJTXXUMV-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|