C24H28N3O3S2+ — CID 121354862
N-ethyl-2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonamide (PubChem CID 121354862) has the molecular formula C24H28N3O3S2+ and a molecular weight of 470.64 g/mol. Its IUPAC name is N-ethyl-2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonamide.
| Compound Name | N-ethyl-2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 121354862 |
| Molecular Formula | C24H28N3O3S2+ |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-ethyl-2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCN1C(=CC(C)=Cc2sc3ccccc3[n+]2CC)Oc2ccccc21 |
| InChI | InChI=1S/C24H28N3O3S2/c1-4-25-32(28,29)15-14-27-19-10-6-8-12-21(19)30-23(27)16-18(3)17-24-26(5-2)20-11-7-9-13-22(20)31-24/h6-13,16-17,25H,4-5,14-15H2,1-3H3/q+1 |
| InChIKey | KIGURCXDPTVZKD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|