C12H13ClNS+ — CID 57015711
2-[(Z)-2-chloroprop-1-enyl]-3-ethyl-1,3-benzothiazol-3-ium (PubChem CID 57015711) has the molecular formula C12H13ClNS+ and a molecular weight of 238.76 g/mol. Its IUPAC name is 2-[(Z)-2-chloroprop-1-enyl]-3-ethyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(Z)-2-chloroprop-1-enyl]-3-ethyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 57015711 |
| Molecular Formula | C12H13ClNS+ |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-[(Z)-2-chloroprop-1-enyl]-3-ethyl-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C(/C)Cl)sc2ccccc21 |
| InChI | InChI=1S/C12H13ClNS/c1-3-14-10-6-4-5-7-11(10)15-12(14)8-9(2)13/h4-8H,3H2,1-2H3/q+1/b9-8- |
| InChIKey | MKOKIRJWFHJOQI-HJWRWDBZSA-N |
| XLogP | 3.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|