C9H10NS2+ — CID 20589270
3-ethyl-1,3-benzothiazol-3-ium-2-thiol (PubChem CID 20589270) has the molecular formula C9H10NS2+ and a molecular weight of 196.32 g/mol. Its IUPAC name is 3-ethyl-1,3-benzothiazol-3-ium-2-thiol.
| Compound Name | 3-ethyl-1,3-benzothiazol-3-ium-2-thiol |
|---|---|
| PubChem CID | 20589270 |
| Molecular Formula | C9H10NS2+ |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 3-ethyl-1,3-benzothiazol-3-ium-2-thiol |
| SMILES | CC[n+]1c(S)sc2ccccc21 |
| InChI | InChI=1S/C9H9NS2/c1-2-10-7-5-3-4-6-8(7)12-9(10)11/h3-6H,2H2,1H3/p+1 |
| InChIKey | HNQNFZRNOJJPFM-UHFFFAOYSA-O |
| XLogP | 2.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|