C19H24NS+ — CID 765950
3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium (PubChem CID 765950) has the molecular formula C19H24NS+ and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium.
| Compound Name | 3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 765950 |
| Molecular Formula | C19H24NS+ |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(/C=C2\C=C(C)CC(C)(C)C2)sc2ccccc21 |
| InChI | InChI=1S/C19H24NS/c1-5-20-16-8-6-7-9-17(16)21-18(20)11-15-10-14(2)12-19(3,4)13-15/h6-11H,5,12-13H2,1-4H3/q+1/b15-11+ |
| InChIKey | HASRMKAJHCVHOP-RVDMUPIBSA-N |
| XLogP | 5.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|