C22H26NS+ — CID 59953972
2-[(E)-[3-[(1E)-buta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium (PubChem CID 59953972) has the molecular formula C22H26NS+ and a molecular weight of 336.52 g/mol. Its IUPAC name is 2-[(E)-[3-[(1E)-buta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-[3-[(1E)-buta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 59953972 |
| Molecular Formula | C22H26NS+ |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[(E)-[3-[(1E)-buta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium |
| SMILES | C=C/C=C/C1=C/C(=C/c2sc3ccccc3[n+]2CC)CC(C)(C)C1 |
| InChI | InChI=1S/C22H26NS/c1-5-7-10-17-13-18(16-22(3,4)15-17)14-21-23(6-2)19-11-8-9-12-20(19)24-21/h5,7-14H,1,6,15-16H2,2-4H3/q+1/b10-7+,18-14- |
| InChIKey | ABUJDNLYJLUOPY-YWAYREADSA-N |
| XLogP | 6.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|