C25H32NOS+ — CID 6911981
2-[(E)-[3-[(1E,3Z)-4-ethoxy-3-methylbuta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium (PubChem CID 6911981) has the molecular formula C25H32NOS+ and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-[(E)-[3-[(1E,3Z)-4-ethoxy-3-methylbuta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-[3-[(1E,3Z)-4-ethoxy-3-methylbuta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 6911981 |
| Molecular Formula | C25H32NOS+ |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[(E)-[3-[(1E,3Z)-4-ethoxy-3-methylbuta-1,3-dienyl]-5,5-dimethylcyclohex-2-en-1-ylidene]methyl]-3-ethyl-1,3-benzothiazol-3-ium |
| SMILES | CCO/C=C(C)\C=C\C1=C/C(=C/c2sc3ccccc3[n+]2CC)CC(C)(C)C1 |
| InChI | InChI=1S/C25H32NOS/c1-6-26-22-10-8-9-11-23(22)28-24(26)15-21-14-20(16-25(4,5)17-21)13-12-19(3)18-27-7-2/h8-15,18H,6-7,16-17H2,1-5H3/q+1/b13-12+,19-18-,21-15- |
| InChIKey | XPDVBUHZHCJFCC-KDSVOXNMSA-N |
| XLogP | 6.84 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|