C37H46N2OS+2 — CID 158287559
2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-1,3-benzothiazol-3-ium;3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzoxazol-3-ium (PubChem CID 158287559) has the molecular formula C37H46N2OS+2 and a molecular weight of 566.86 g/mol. Its IUPAC name is 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-1,3-benzothiazol-3-ium;3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzoxazol-3-ium.
| Compound Name | 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-1,3-benzothiazol-3-ium;3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 158287559 |
| Molecular Formula | C37H46N2OS+2 |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 2-[(E)-(3,5-dimethylcyclohex-2-en-1-ylidene)methyl]-3-ethyl-1,3-benzothiazol-3-ium;3-ethyl-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]-1,3-benzoxazol-3-ium |
| SMILES | CC[n+]1c(/C=C2/C=C(C)CC(C)C2)sc2ccccc21.CC[n+]1c(/C=C2\C=C(C)CC(C)(C)C2)oc2ccccc21 |
| InChI | InChI=1S/C19H24NO.C18H22NS/c1-5-20-16-8-6-7-9-17(16)21-18(20)11-15-10-14(2)12-19(3,4)13-15;1-4-19-16-7-5-6-8-17(16)20-18(19)12-15-10-13(2)9-14(3)11-15/h6-11H,5,12-13H2,1-4H3;5-8,10,12,14H,4,9,11H2,1-3H3/q2*+1/b15-11+;15-12- |
| InChIKey | GKYTYPJGIZIJJF-VCLMDHSPSA-N |
| XLogP | 9.86 |
| TPSA | 20.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|