C15H19N2OS+ — CID 54329545
3-ethyl-2-[(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium (PubChem CID 54329545) has the molecular formula C15H19N2OS+ and a molecular weight of 275.40 g/mol. Its IUPAC name is 3-ethyl-2-[(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium.
| Compound Name | 3-ethyl-2-[(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 54329545 |
| Molecular Formula | C15H19N2OS+ |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-ethyl-2-[(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium |
| SMILES | CCN1CCSC1=Cc1oc2ccccc2[n+]1CC |
| InChI | InChI=1S/C15H19N2OS/c1-3-16-9-10-19-15(16)11-14-17(4-2)12-7-5-6-8-13(12)18-14/h5-8,11H,3-4,9-10H2,1-2H3/q+1 |
| InChIKey | SXJBSQABSLLAPQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|