C15H19IN2OS — CID 135815816
3-ethyl-2-[(Z)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium iodide (PubChem CID 135815816) has the molecular formula C15H19IN2OS and a molecular weight of 402.30 g/mol. Its IUPAC name is 3-ethyl-2-[(Z)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium iodide.
| Compound Name | 3-ethyl-2-[(Z)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium iodide |
|---|---|
| PubChem CID | 135815816 |
| Molecular Formula | C15H19IN2OS |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 3-ethyl-2-[(Z)-(3-ethyl-1,3-thiazolidin-2-ylidene)methyl]-1,3-benzoxazol-3-ium iodide |
| SMILES | CCN1CCS/C1=C\c1oc2ccccc2[n+]1CC.[I-] |
| InChI | InChI=1S/C15H19N2OS.HI/c1-3-16-9-10-19-15(16)11-14-17(4-2)12-7-5-6-8-13(12)18-14;/h5-8,11H,3-4,9-10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HTKZKYUADMXOHI-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|