C19H21IN2O — CID 67680807
4-[(E)-2-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide (PubChem CID 67680807) has the molecular formula C19H21IN2O and a molecular weight of 420.29 g/mol. Its IUPAC name is 4-[(E)-2-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[(E)-2-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 67680807 |
| Molecular Formula | C19H21IN2O |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 4-[(E)-2-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline iodide |
| SMILES | CC[n+]1c(/C=C/c2ccc(N(C)C)cc2)oc2ccccc21.[I-] |
| InChI | InChI=1S/C19H21N2O.HI/c1-4-21-17-7-5-6-8-18(17)22-19(21)14-11-15-9-12-16(13-10-15)20(2)3;/h5-14H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FKIKTPNDLOMEJG-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|