C19H21N2Se+ — CID 58082011
4-[(E)-2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 58082011) has the molecular formula C19H21N2Se+ and a molecular weight of 356.35 g/mol. Its IUPAC name is 4-[(E)-2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 58082011 |
| Molecular Formula | C19H21N2Se+ |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-[(E)-2-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CC[n+]1c(/C=C/c2ccc(N(C)C)cc2)[se]c2ccccc21 |
| InChI | InChI=1S/C19H21N2Se/c1-4-21-17-7-5-6-8-18(17)22-19(21)14-11-15-9-12-16(13-10-15)20(2)3/h5-14H,4H2,1-3H3/q+1 |
| InChIKey | DSQWNMPKWPCEOX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|