C22H28IN3Se — CID 173417205
4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzoselenazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide (PubChem CID 173417205) has the molecular formula C22H28IN3Se and a molecular weight of 540.35 g/mol. Its IUPAC name is 4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzoselenazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzoselenazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 173417205 |
| Molecular Formula | C22H28IN3Se |
| Molecular Weight | 540.35 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 4-[2-[3-[3-(dimethylamino)propyl]-1,3-benzoselenazol-3-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide |
| SMILES | CN(C)CCC[n+]1c(C=Cc2ccc(N(C)C)cc2)[se]c2ccccc21.[I-] |
| InChI | InChI=1S/C22H28N3Se.HI/c1-23(2)16-7-17-25-20-8-5-6-9-21(20)26-22(25)15-12-18-10-13-19(14-11-18)24(3)4;/h5-6,8-15H,7,16-17H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HGSZQJWLDXAXHJ-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|