C21H23IN2 — CID 67531085
N,N-dimethyl-4-(4-quinolin-1-ium-1-ylbut-1-enyl)aniline iodide (PubChem CID 67531085) has the molecular formula C21H23IN2 and a molecular weight of 430.33 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-quinolin-1-ium-1-ylbut-1-enyl)aniline iodide.
| Compound Name | N,N-dimethyl-4-(4-quinolin-1-ium-1-ylbut-1-enyl)aniline iodide |
|---|---|
| PubChem CID | 67531085 |
| Molecular Formula | C21H23IN2 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N,N-dimethyl-4-(4-quinolin-1-ium-1-ylbut-1-enyl)aniline iodide |
| SMILES | CN(C)c1ccc(C=CCC[n+]2cccc3ccccc32)cc1.[I-] |
| InChI | InChI=1S/C21H23N2.HI/c1-22(2)20-14-12-18(13-15-20)8-5-6-16-23-17-7-10-19-9-3-4-11-21(19)23;/h3-5,7-15,17H,6,16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BFABKQJJROURIW-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|