C24H29N2+ — CID 76662141
N,N-dimethyl-4-[2-[1-(3-methylbutyl)quinolin-1-ium-4-yl]ethenyl]aniline (PubChem CID 76662141) has the molecular formula C24H29N2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[1-(3-methylbutyl)quinolin-1-ium-4-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[1-(3-methylbutyl)quinolin-1-ium-4-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 76662141 |
| Molecular Formula | C24H29N2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N,N-dimethyl-4-[2-[1-(3-methylbutyl)quinolin-1-ium-4-yl]ethenyl]aniline |
| SMILES | CC(C)CC[n+]1ccc(C=Cc2ccc(N(C)C)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H29N2/c1-19(2)15-17-26-18-16-21(23-7-5-6-8-24(23)26)12-9-20-10-13-22(14-11-20)25(3)4/h5-14,16,18-19H,15,17H2,1-4H3/q+1 |
| InChIKey | YROPLQXDUXVCPO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|