C22H23Cl2N2+ — CID 3378359
N,N-bis(2-chloroethyl)-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline (PubChem CID 3378359) has the molecular formula C22H23Cl2N2+ and a molecular weight of 386.35 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline.
| Compound Name | N,N-bis(2-chloroethyl)-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 3378359 |
| Molecular Formula | C22H23Cl2N2+ |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N,N-bis(2-chloroethyl)-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline |
| SMILES | C[n+]1ccc(C=Cc2ccc(N(CCCl)CCCl)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H23Cl2N2/c1-25-15-12-19(21-4-2-3-5-22(21)25)9-6-18-7-10-20(11-8-18)26(16-13-23)17-14-24/h2-12,15H,13-14,16-17H2,1H3/q+1 |
| InChIKey | SLCYPWVMVYIMNI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|