C21H24N3O2+ — CID 174647077
2-aminopropanoic acid;4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline (PubChem CID 174647077) has the molecular formula C21H24N3O2+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-aminopropanoic acid;4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline.
| Compound Name | 2-aminopropanoic acid;4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 174647077 |
| Molecular Formula | C21H24N3O2+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-aminopropanoic acid;4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]aniline |
| SMILES | CC(N)C(=O)O.C[n+]1ccc(C=Cc2ccc(N)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H16N2.C3H7NO2/c1-20-13-12-15(17-4-2-3-5-18(17)20)9-6-14-7-10-16(19)11-8-14;1-2(4)3(5)6/h2-13,19H,1H3;2H,4H2,1H3,(H,5,6)/p+1 |
| InChIKey | JSPUFUZZEZHVIS-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|