C27H24NO4+ — CID 54248660
[2,6-dimethoxy-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl] benzoate (PubChem CID 54248660) has the molecular formula C27H24NO4+ and a molecular weight of 426.49 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl] benzoate.
| Compound Name | [2,6-dimethoxy-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl] benzoate |
|---|---|
| PubChem CID | 54248660 |
| Molecular Formula | C27H24NO4+ |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [2,6-dimethoxy-4-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]phenyl] benzoate |
| SMILES | COc1cc(C=Cc2cc[n+](C)c3ccccc23)cc(OC)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24NO4/c1-28-16-15-20(22-11-7-8-12-23(22)28)14-13-19-17-24(30-2)26(25(18-19)31-3)32-27(29)21-9-5-4-6-10-21/h4-18H,1-3H3/q+1 |
| InChIKey | QVDJELIYUQIHKR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|